C18H18O2 — CID 14971118
(1S,5R,8S,12R)-3,10-dimethoxypentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2,4(9),6,10,13-pentaene (PubChem CID 14971118) has the molecular formula C18H18O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is (1S,5R,8S,12R)-3,10-dimethoxypentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2,4(9),6,10,13-pentaene.
| Compound Name | (1S,5R,8S,12R)-3,10-dimethoxypentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2,4(9),6,10,13-pentaene |
|---|---|
| PubChem CID | 14971118 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (1S,5R,8S,12R)-3,10-dimethoxypentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2,4(9),6,10,13-pentaene |
| SMILES | COc1c2c(c(OC)c3c1[C@H]1C=C[C@@H]3C1)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C18H18O2/c1-19-17-13-9-3-5-11(7-9)15(13)18(20-2)16-12-6-4-10(8-12)14(16)17/h3-6,9-12H,7-8H2,1-2H3/t9-,10+,11+,12- |
| InChIKey | GLLVVDNOICLGOF-IWDIQUIJSA-N |
| XLogP | 3.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|