C30H26O2 — CID 98164270
(1R,12R)-3,10-dimethoxy-5,8-diphenyltetracyclo[10.2.2.02,11.04,9]hexadeca-2,4,6,8,10,13-hexaene (PubChem CID 98164270) has the molecular formula C30H26O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is (1R,12R)-3,10-dimethoxy-5,8-diphenyltetracyclo[10.2.2.02,11.04,9]hexadeca-2,4,6,8,10,13-hexaene.
| Compound Name | (1R,12R)-3,10-dimethoxy-5,8-diphenyltetracyclo[10.2.2.02,11.04,9]hexadeca-2,4,6,8,10,13-hexaene |
|---|---|
| PubChem CID | 98164270 |
| Molecular Formula | C30H26O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | (1R,12R)-3,10-dimethoxy-5,8-diphenyltetracyclo[10.2.2.02,11.04,9]hexadeca-2,4,6,8,10,13-hexaene |
| SMILES | COc1c2c(c(OC)c3c(-c4ccccc4)ccc(-c4ccccc4)c13)[C@H]1C=C[C@H]2CC1 |
| InChI | InChI=1S/C30H26O2/c1-31-29-25-21-13-15-22(16-14-21)26(25)30(32-2)28-24(20-11-7-4-8-12-20)18-17-23(27(28)29)19-9-5-3-6-10-19/h3-13,15,17-18,21-22H,14,16H2,1-2H3/t21-,22-/m0/s1 |
| InChIKey | ODOGARMFEMCUBA-VXKWHMMOSA-N |
| XLogP | 7.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|