C28H23NO3 — CID 90871097
(1S,7R)-4-[3-(2-hydroxy-3-phenylphenyl)phenyl]-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3,5-diol (PubChem CID 90871097) has the molecular formula C28H23NO3 and a molecular weight of 421.50 g/mol. Its IUPAC name is (1S,7R)-4-[3-(2-hydroxy-3-phenylphenyl)phenyl]-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3,5-diol.
| Compound Name | (1S,7R)-4-[3-(2-hydroxy-3-phenylphenyl)phenyl]-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3,5-diol |
|---|---|
| PubChem CID | 90871097 |
| Molecular Formula | C28H23NO3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | (1S,7R)-4-[3-(2-hydroxy-3-phenylphenyl)phenyl]-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3,5-diol |
| SMILES | Oc1c(-c2ccccc2)cccc1-c1cccc(-n2c(O)c3c(c2O)[C@H]2C=C[C@@H]3CC2)c1 |
| InChI | InChI=1S/C28H23NO3/c30-26-22(17-6-2-1-3-7-17)10-5-11-23(26)20-8-4-9-21(16-20)29-27(31)24-18-12-13-19(15-14-18)25(24)28(29)32/h1-13,16,18-19,30-32H,14-15H2/t18-,19+ |
| InChIKey | MQDDJMSSRCWYRK-KDURUIRLSA-N |
| XLogP | 6.46 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|