C16H14Br2N2O4S — CID 91068635
2,6-dibromo-4-[(1R,7S)-3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-4-yl]benzenesulfonamide (PubChem CID 91068635) has the molecular formula C16H14Br2N2O4S and a molecular weight of 490.17 g/mol. Its IUPAC name is 2,6-dibromo-4-[(1R,7S)-3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-4-yl]benzenesulfonamide.
| Compound Name | 2,6-dibromo-4-[(1R,7S)-3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 91068635 |
| Molecular Formula | C16H14Br2N2O4S |
| Molecular Weight | 490.17 g/mol |
| Exact Mass | 487.90 |
| IUPAC Name | 2,6-dibromo-4-[(1R,7S)-3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-4-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(Br)cc(-n2c(O)c3c(c2O)[C@H]2C=C[C@@H]3CC2)cc1Br |
| InChI | InChI=1S/C16H14Br2N2O4S/c17-10-5-9(6-11(18)14(10)25(19,23)24)20-15(21)12-7-1-2-8(4-3-7)13(12)16(20)22/h1-2,5-8,21-22H,3-4H2,(H2,19,23,24)/t7-,8+ |
| InChIKey | DDJIFFZHOHCSGI-OCAPTIKFSA-N |
| XLogP | 3.59 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.17 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|