C18H19NO3 — CID 91395329
(1S,7R)-4-(2-hydroxy-4,5-dimethylphenyl)-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3,5-diol (PubChem CID 91395329) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is (1S,7R)-4-(2-hydroxy-4,5-dimethylphenyl)-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3,5-diol.
| Compound Name | (1S,7R)-4-(2-hydroxy-4,5-dimethylphenyl)-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3,5-diol |
|---|---|
| PubChem CID | 91395329 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (1S,7R)-4-(2-hydroxy-4,5-dimethylphenyl)-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3,5-diol |
| SMILES | Cc1cc(O)c(-n2c(O)c3c(c2O)[C@H]2C=C[C@@H]3CC2)cc1C |
| InChI | InChI=1S/C18H19NO3/c1-9-7-13(14(20)8-10(9)2)19-17(21)15-11-3-4-12(6-5-11)16(15)18(19)22/h3-4,7-8,11-12,20-22H,5-6H2,1-2H3/t11-,12+ |
| InChIKey | ROKGGRXSRNALEI-TXEJJXNPSA-N |
| XLogP | 3.74 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|