C12H12O2 — CID 130033714
tricyclo[6.2.2.02,7]dodeca-2(7),3,5,9-tetraene-3,4-diol (PubChem CID 130033714) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is tricyclo[6.2.2.02,7]dodeca-2(7),3,5,9-tetraene-3,4-diol.
| Compound Name | tricyclo[6.2.2.02,7]dodeca-2(7),3,5,9-tetraene-3,4-diol |
|---|---|
| PubChem CID | 130033714 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | tricyclo[6.2.2.02,7]dodeca-2(7),3,5,9-tetraene-3,4-diol |
| SMILES | Oc1ccc2c(c1O)C1C=CC2CC1 |
| InChI | InChI=1S/C12H12O2/c13-10-6-5-9-7-1-3-8(4-2-7)11(9)12(10)14/h1,3,5-8,13-14H,2,4H2 |
| InChIKey | ZYIWMRCJNNUAKB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|