C13H16O2 — CID 92980858
3-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]benzene-1,2-diol (PubChem CID 92980858) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 3-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]benzene-1,2-diol.
| Compound Name | 3-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 92980858 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 3-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]benzene-1,2-diol |
| SMILES | Oc1cccc([C@@H]2C[C@H]3CC[C@@H]2C3)c1O |
| InChI | InChI=1S/C13H16O2/c14-12-3-1-2-10(13(12)15)11-7-8-4-5-9(11)6-8/h1-3,8-9,11,14-15H,4-7H2/t8-,9+,11+/m0/s1 |
| InChIKey | DWWJNUSFHLSDSW-IQJOONFLSA-N |
| XLogP | 3.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|