C19H20 — CID 16687687
(1S,2S,4R)-2-(2-phenylphenyl)bicyclo[2.2.1]heptane (PubChem CID 16687687) has the molecular formula C19H20 and a molecular weight of 248.37 g/mol. Its IUPAC name is (1S,2S,4R)-2-(2-phenylphenyl)bicyclo[2.2.1]heptane.
| Compound Name | (1S,2S,4R)-2-(2-phenylphenyl)bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 16687687 |
| Molecular Formula | C19H20 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | (1S,2S,4R)-2-(2-phenylphenyl)bicyclo[2.2.1]heptane |
| SMILES | c1ccc(-c2ccccc2[C@H]2C[C@@H]3CC[C@H]2C3)cc1 |
| InChI | InChI=1S/C19H20/c1-2-6-15(7-3-1)17-8-4-5-9-18(17)19-13-14-10-11-16(19)12-14/h1-9,14,16,19H,10-13H2/t14-,16+,19+/m1/s1 |
| InChIKey | ZWKPYINNFKMLII-ALKREAHSSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |