C14H18 — CID 10397553
(1R,2R,4S)-2-(2-methylphenyl)bicyclo[2.2.1]heptane (PubChem CID 10397553) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is (1R,2R,4S)-2-(2-methylphenyl)bicyclo[2.2.1]heptane.
| Compound Name | (1R,2R,4S)-2-(2-methylphenyl)bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 10397553 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (1R,2R,4S)-2-(2-methylphenyl)bicyclo[2.2.1]heptane |
| SMILES | Cc1ccccc1[C@@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C14H18/c1-10-4-2-3-5-13(10)14-9-11-6-7-12(14)8-11/h2-5,11-12,14H,6-9H2,1H3/t11-,12+,14+/m0/s1 |
| InChIKey | WRTNCKUMHKXQRM-OUCADQQQSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |