C18H20 — CID 153281935
1-(2-bicyclo[2.2.1]heptanyl)-3-methylnaphthalene (PubChem CID 153281935) has the molecular formula C18H20 and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-3-methylnaphthalene.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-3-methylnaphthalene |
|---|---|
| PubChem CID | 153281935 |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-3-methylnaphthalene |
| SMILES | Cc1cc(C2CC3CCC2C3)c2ccccc2c1 |
| InChI | InChI=1S/C18H20/c1-12-8-14-4-2-3-5-16(14)18(9-12)17-11-13-6-7-15(17)10-13/h2-5,8-9,13,15,17H,6-7,10-11H2,1H3 |
| InChIKey | AWNLMCZRQFILCI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |