C15H20 — CID 101176008
(1R,2R,4S)-2-(3,5-dimethylphenyl)bicyclo[2.2.1]heptane (PubChem CID 101176008) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is (1R,2R,4S)-2-(3,5-dimethylphenyl)bicyclo[2.2.1]heptane.
| Compound Name | (1R,2R,4S)-2-(3,5-dimethylphenyl)bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 101176008 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | (1R,2R,4S)-2-(3,5-dimethylphenyl)bicyclo[2.2.1]heptane |
| SMILES | Cc1cc(C)cc([C@@H]2C[C@H]3CC[C@@H]2C3)c1 |
| InChI | InChI=1S/C15H20/c1-10-5-11(2)7-14(6-10)15-9-12-3-4-13(15)8-12/h5-7,12-13,15H,3-4,8-9H2,1-2H3/t12-,13+,15+/m0/s1 |
| InChIKey | HKZQEMJJXPBBEO-GZBFAFLISA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |