C14H15N — CID 16688303
3-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]benzonitrile (PubChem CID 16688303) has the molecular formula C14H15N and a molecular weight of 197.28 g/mol. Its IUPAC name is 3-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]benzonitrile.
| Compound Name | 3-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]benzonitrile |
|---|---|
| PubChem CID | 16688303 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 3-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]benzonitrile |
| SMILES | N#Cc1cccc([C@H]2C[C@@H]3CC[C@H]2C3)c1 |
| InChI | InChI=1S/C14H15N/c15-9-11-2-1-3-12(7-11)14-8-10-4-5-13(14)6-10/h1-3,7,10,13-14H,4-6,8H2/t10-,13+,14-/m1/s1 |
| InChIKey | RMZUSWJZQXFQGJ-DDTOSNHZSA-N |
| XLogP | 3.46 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |