C12H16S — CID 121002337
2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-4-methylthiophene (PubChem CID 121002337) has the molecular formula C12H16S and a molecular weight of 192.33 g/mol. Its IUPAC name is 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-4-methylthiophene.
| Compound Name | 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-4-methylthiophene |
|---|---|
| PubChem CID | 121002337 |
| Molecular Formula | C12H16S |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-4-methylthiophene |
| SMILES | Cc1csc([C@@H]2C[C@H]3CC[C@@H]2C3)c1 |
| InChI | InChI=1S/C12H16S/c1-8-4-12(13-7-8)11-6-9-2-3-10(11)5-9/h4,7,9-11H,2-3,5-6H2,1H3/t9-,10+,11+/m0/s1 |
| InChIKey | IEZOMCKERBWFDQ-HBNTYKKESA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |