C10H13NOS — CID 130640818
4-(2-bicyclo[2.2.1]heptanyl)-3H-1,3-thiazol-2-one (PubChem CID 130640818) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is 4-(2-bicyclo[2.2.1]heptanyl)-3H-1,3-thiazol-2-one.
| Compound Name | 4-(2-bicyclo[2.2.1]heptanyl)-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 130640818 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 4-(2-bicyclo[2.2.1]heptanyl)-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(C2CC3CCC2C3)cs1 |
| InChI | InChI=1S/C10H13NOS/c12-10-11-9(5-13-10)8-4-6-1-2-7(8)3-6/h5-8H,1-4H2,(H,11,12) |
| InChIKey | KCBAXWXQYCCSCO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |