C12H15NO — CID 19748684
3-(2-bicyclo[2.2.1]heptanyl)-1H-pyridin-2-one (PubChem CID 19748684) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.1]heptanyl)-1H-pyridin-2-one.
| Compound Name | 3-(2-bicyclo[2.2.1]heptanyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 19748684 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 3-(2-bicyclo[2.2.1]heptanyl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]cccc1C1CC2CCC1C2 |
| InChI | InChI=1S/C12H15NO/c14-12-10(2-1-5-13-12)11-7-8-3-4-9(11)6-8/h1-2,5,8-9,11H,3-4,6-7H2,(H,13,14) |
| InChIKey | BWSOCEZUTRRFOR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |