C19H20O — CID 122390793
1-[2-(2-bicyclo[2.2.1]heptanyl)naphthalen-1-yl]ethanone (PubChem CID 122390793) has the molecular formula C19H20O and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-[2-(2-bicyclo[2.2.1]heptanyl)naphthalen-1-yl]ethanone.
| Compound Name | 1-[2-(2-bicyclo[2.2.1]heptanyl)naphthalen-1-yl]ethanone |
|---|---|
| PubChem CID | 122390793 |
| Molecular Formula | C19H20O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 1-[2-(2-bicyclo[2.2.1]heptanyl)naphthalen-1-yl]ethanone |
| SMILES | CC(=O)c1c(C2CC3CCC2C3)ccc2ccccc12 |
| InChI | InChI=1S/C19H20O/c1-12(20)19-16-5-3-2-4-14(16)8-9-17(19)18-11-13-6-7-15(18)10-13/h2-5,8-9,13,15,18H,6-7,10-11H2,1H3 |
| InChIKey | CIISDYUCVLRPDI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |