C14H20 — CID 59774098
1-[(1R,2R)-2-tert-butylcyclopropyl]-2-methylbenzene (PubChem CID 59774098) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is 1-[(1R,2R)-2-tert-butylcyclopropyl]-2-methylbenzene.
| Compound Name | 1-[(1R,2R)-2-tert-butylcyclopropyl]-2-methylbenzene |
|---|---|
| PubChem CID | 59774098 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 1-[(1R,2R)-2-tert-butylcyclopropyl]-2-methylbenzene |
| SMILES | Cc1ccccc1[C@@H]1C[C@H]1C(C)(C)C |
| InChI | InChI=1S/C14H20/c1-10-7-5-6-8-11(10)12-9-13(12)14(2,3)4/h5-8,12-13H,9H2,1-4H3/t12-,13+/m0/s1 |
| InChIKey | CVOBSIRUTOPMHV-QWHCGFSZSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |