C12H17N — CID 28912263
(1R)-1-[(1S,2S)-2-(2-methylphenyl)cyclopropyl]ethanamine (PubChem CID 28912263) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is (1R)-1-[(1S,2S)-2-(2-methylphenyl)cyclopropyl]ethanamine.
| Compound Name | (1R)-1-[(1S,2S)-2-(2-methylphenyl)cyclopropyl]ethanamine |
|---|---|
| PubChem CID | 28912263 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (1R)-1-[(1S,2S)-2-(2-methylphenyl)cyclopropyl]ethanamine |
| SMILES | Cc1ccccc1[C@H]1C[C@@H]1[C@@H](C)N |
| InChI | InChI=1S/C12H17N/c1-8-5-3-4-6-10(8)12-7-11(12)9(2)13/h3-6,9,11-12H,7,13H2,1-2H3/t9-,11-,12-/m1/s1 |
| InChIKey | PENZOSOLHRPJDU-YUSALJHKSA-N |
| XLogP | 2.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |