C18H20O8 — CID 163517602
4-[2,4-dimethoxy-3-(2,3,4-trihydroxyphenyl)cyclobutyl]benzene-1,2,3-triol (PubChem CID 163517602) has the molecular formula C18H20O8 and a molecular weight of 364.35 g/mol. Its IUPAC name is 4-[2,4-dimethoxy-3-(2,3,4-trihydroxyphenyl)cyclobutyl]benzene-1,2,3-triol.
| Compound Name | 4-[2,4-dimethoxy-3-(2,3,4-trihydroxyphenyl)cyclobutyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 163517602 |
| Molecular Formula | C18H20O8 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 4-[2,4-dimethoxy-3-(2,3,4-trihydroxyphenyl)cyclobutyl]benzene-1,2,3-triol |
| SMILES | COC1C(c2ccc(O)c(O)c2O)C(OC)C1c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C18H20O8/c1-25-17-11(7-3-5-9(19)15(23)13(7)21)18(26-2)12(17)8-4-6-10(20)16(24)14(8)22/h3-6,11-12,17-24H,1-2H3 |
| InChIKey | DIBZRNZESLDHBO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|