C12H16O4 — CID 142657072
4-cyclopentyloxy-3-methoxybenzene-1,2-diol (PubChem CID 142657072) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 4-cyclopentyloxy-3-methoxybenzene-1,2-diol.
| Compound Name | 4-cyclopentyloxy-3-methoxybenzene-1,2-diol |
|---|---|
| PubChem CID | 142657072 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 4-cyclopentyloxy-3-methoxybenzene-1,2-diol |
| SMILES | COc1c(OC2CCCC2)ccc(O)c1O |
| InChI | InChI=1S/C12H16O4/c1-15-12-10(7-6-9(13)11(12)14)16-8-4-2-3-5-8/h6-8,13-14H,2-5H2,1H3 |
| InChIKey | PWFJMUQXFNGERK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|