About 2,5-dicyclohexyloxyphenol
2,5-dicyclohexyloxyphenol (PubChem CID 139941916) has the molecular formula C18H26O3
and a molecular weight of 290.40 g/mol. Its IUPAC name is 2,5-dicyclohexyloxyphenol.
Molecular Properties
| Compound Name | 2,5-dicyclohexyloxyphenol |
| PubChem CID | 139941916 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 2,5-dicyclohexyloxyphenol |
| SMILES | Oc1cc(OC2CCCCC2)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C18H26O3/c19-17-13-16(20-14-7-3-1-4-8-14)11-12-18(17)21-15-9-5-2-6-10-15/h11-15,19H,1-10H2 |
| InChIKey | MCVBZVNGOGWZNG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-dicyclohexyloxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dicyclohexyloxyphenol?
The IUPAC name of 2,5-dicyclohexyloxyphenol (CID 139941916) is 2,5-dicyclohexyloxyphenol.
What is the SMILES notation for 2,5-dicyclohexyloxyphenol?
The canonical SMILES for 2,5-dicyclohexyloxyphenol is Oc1cc(OC2CCCCC2)ccc1OC1CCCCC1.
What is the InChIKey of 2,5-dicyclohexyloxyphenol?
The InChIKey is MCVBZVNGOGWZNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O3/c19-17-13-16(20-14-7-3-1-4-8-14)11-12-18(17)21-15-9-5-2-6-10-15/h11-15,19H,1-10H2.
What are the key properties of 2,5-dicyclohexyloxyphenol?
2,5-dicyclohexyloxyphenol has a molecular weight of 290.40 g/mol, XLogP of 4.82, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dicyclohexyloxyphenol is sourced from PubChem (CID 139941916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).