C18H26O3 — CID 21489857
3,5-dicyclohexyloxyphenol (PubChem CID 21489857) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is 3,5-dicyclohexyloxyphenol.
| Compound Name | 3,5-dicyclohexyloxyphenol |
|---|---|
| PubChem CID | 21489857 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 3,5-dicyclohexyloxyphenol |
| SMILES | Oc1cc(OC2CCCCC2)cc(OC2CCCCC2)c1 |
| InChI | InChI=1S/C18H26O3/c19-14-11-17(20-15-7-3-1-4-8-15)13-18(12-14)21-16-9-5-2-6-10-16/h11-13,15-16,19H,1-10H2 |
| InChIKey | AMDOEQPBXNCRNB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |