C14H17NO3 — CID 18470646
2-cyclopentyloxy-3,4-dimethoxybenzonitrile (PubChem CID 18470646) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 2-cyclopentyloxy-3,4-dimethoxybenzonitrile.
| Compound Name | 2-cyclopentyloxy-3,4-dimethoxybenzonitrile |
|---|---|
| PubChem CID | 18470646 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 2-cyclopentyloxy-3,4-dimethoxybenzonitrile |
| SMILES | COc1ccc(C#N)c(OC2CCCC2)c1OC |
| InChI | InChI=1S/C14H17NO3/c1-16-12-8-7-10(9-15)13(14(12)17-2)18-11-5-3-4-6-11/h7-8,11H,3-6H2,1-2H3 |
| InChIKey | KADRHQQOARAKIY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |