C13H16N2O3 — CID 18470654
6-amino-2-cyclobutyloxy-3,4-dimethoxybenzonitrile (PubChem CID 18470654) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 6-amino-2-cyclobutyloxy-3,4-dimethoxybenzonitrile.
| Compound Name | 6-amino-2-cyclobutyloxy-3,4-dimethoxybenzonitrile |
|---|---|
| PubChem CID | 18470654 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 6-amino-2-cyclobutyloxy-3,4-dimethoxybenzonitrile |
| SMILES | COc1cc(N)c(C#N)c(OC2CCC2)c1OC |
| InChI | InChI=1S/C13H16N2O3/c1-16-11-6-10(15)9(7-14)12(13(11)17-2)18-8-4-3-5-8/h6,8H,3-5,15H2,1-2H3 |
| InChIKey | CHVCWCCUWLHICB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|