C14H20O2 — CID 154435911
3-cyclohexyl-4-ethylbenzene-1,2-diol (PubChem CID 154435911) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 3-cyclohexyl-4-ethylbenzene-1,2-diol.
| Compound Name | 3-cyclohexyl-4-ethylbenzene-1,2-diol |
|---|---|
| PubChem CID | 154435911 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 3-cyclohexyl-4-ethylbenzene-1,2-diol |
| SMILES | CCc1ccc(O)c(O)c1C1CCCCC1 |
| InChI | InChI=1S/C14H20O2/c1-2-10-8-9-12(15)14(16)13(10)11-6-4-3-5-7-11/h8-9,11,15-16H,2-7H2,1H3 |
| InChIKey | VKWRLESDUVLDGS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|