C8H9IO2 — CID 118010885
4-ethyl-3-iodobenzene-1,2-diol (PubChem CID 118010885) has the molecular formula C8H9IO2 and a molecular weight of 264.06 g/mol. Its IUPAC name is 4-ethyl-3-iodobenzene-1,2-diol.
| Compound Name | 4-ethyl-3-iodobenzene-1,2-diol |
|---|---|
| PubChem CID | 118010885 |
| Molecular Formula | C8H9IO2 |
| Molecular Weight | 264.06 g/mol |
| Exact Mass | 263.96 |
| IUPAC Name | 4-ethyl-3-iodobenzene-1,2-diol |
| SMILES | CCc1ccc(O)c(O)c1I |
| InChI | InChI=1S/C8H9IO2/c1-2-5-3-4-6(10)8(11)7(5)9/h3-4,10-11H,2H2,1H3 |
| InChIKey | TULARFQWKBNJSR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.06 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|