C10H14O5 — CID 174644539
benzene-1,2,3,4-tetrol;butan-2-one (PubChem CID 174644539) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is benzene-1,2,3,4-tetrol;butan-2-one.
| Compound Name | benzene-1,2,3,4-tetrol;butan-2-one |
|---|---|
| PubChem CID | 174644539 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | benzene-1,2,3,4-tetrol;butan-2-one |
| SMILES | CCC(C)=O.Oc1ccc(O)c(O)c1O |
| InChI | InChI=1S/C6H6O4.C4H8O/c7-3-1-2-4(8)6(10)5(3)9;1-3-4(2)5/h1-2,7-10H;3H2,1-2H3 |
| InChIKey | SEMXARCPPIDSMB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|