C9H11NO4 — CID 160759755
N-[(2,3,4-trihydroxyphenyl)methyl]acetamide (PubChem CID 160759755) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is N-[(2,3,4-trihydroxyphenyl)methyl]acetamide.
| Compound Name | N-[(2,3,4-trihydroxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 160759755 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | N-[(2,3,4-trihydroxyphenyl)methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(O)c(O)c1O |
| InChI | InChI=1S/C9H11NO4/c1-5(11)10-4-6-2-3-7(12)9(14)8(6)13/h2-3,12-14H,4H2,1H3,(H,10,11) |
| InChIKey | YHKKSLUFKMGALG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|