C10H10ClF2NO — CID 118212780
N-[[4-(chloromethyl)-2,3-difluorophenyl]methyl]acetamide (PubChem CID 118212780) has the molecular formula C10H10ClF2NO and a molecular weight of 233.64 g/mol. Its IUPAC name is N-[[4-(chloromethyl)-2,3-difluorophenyl]methyl]acetamide.
| Compound Name | N-[[4-(chloromethyl)-2,3-difluorophenyl]methyl]acetamide |
|---|---|
| PubChem CID | 118212780 |
| Molecular Formula | C10H10ClF2NO |
| Molecular Weight | 233.64 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | N-[[4-(chloromethyl)-2,3-difluorophenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(CCl)c(F)c1F |
| InChI | InChI=1S/C10H10ClF2NO/c1-6(15)14-5-8-3-2-7(4-11)9(12)10(8)13/h2-3H,4-5H2,1H3,(H,14,15) |
| InChIKey | IGYYKRKYEWBQLZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.64 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|