C11H13F2NO — CID 123262796
N-[(4-ethyl-2,3-difluorophenyl)methyl]acetamide (PubChem CID 123262796) has the molecular formula C11H13F2NO and a molecular weight of 213.23 g/mol. Its IUPAC name is N-[(4-ethyl-2,3-difluorophenyl)methyl]acetamide.
| Compound Name | N-[(4-ethyl-2,3-difluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 123262796 |
| Molecular Formula | C11H13F2NO |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | N-[(4-ethyl-2,3-difluorophenyl)methyl]acetamide |
| SMILES | CCc1ccc(CNC(C)=O)c(F)c1F |
| InChI | InChI=1S/C11H13F2NO/c1-3-8-4-5-9(6-14-7(2)15)11(13)10(8)12/h4-5H,3,6H2,1-2H3,(H,14,15) |
| InChIKey | DAZIMRTZFUFAED-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |