About 4-(hydrazinylmethyl)benzene-1,2,3-triol;methanol
4-(hydrazinylmethyl)benzene-1,2,3-triol;methanol (PubChem CID 90472349) has the molecular formula C8H14N2O4
and a molecular weight of 202.21 g/mol. Its IUPAC name is 4-(hydrazinylmethyl)benzene-1,2,3-triol;methanol.
Molecular Properties
| Compound Name | 4-(hydrazinylmethyl)benzene-1,2,3-triol;methanol |
| PubChem CID | 90472349 |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 4-(hydrazinylmethyl)benzene-1,2,3-triol;methanol |
| SMILES | CO.NNCc1ccc(O)c(O)c1O |
| InChI | InChI=1S/C7H10N2O3.CH4O/c8-9-3-4-1-2-5(10)7(12)6(4)11;1-2/h1-2,9-12H,3,8H2;2H,1H3 |
| InChIKey | OITNVDWKAYXSQO-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(hydrazinylmethyl)benzene-1,2,3-triol;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydrazinylmethyl)benzene-1,2,3-triol;methanol?
The IUPAC name of 4-(hydrazinylmethyl)benzene-1,2,3-triol;methanol (CID 90472349) is 4-(hydrazinylmethyl)benzene-1,2,3-triol;methanol.
What is the SMILES notation for 4-(hydrazinylmethyl)benzene-1,2,3-triol;methanol?
The canonical SMILES for 4-(hydrazinylmethyl)benzene-1,2,3-triol;methanol is CO.NNCc1ccc(O)c(O)c1O.
What is the InChIKey of 4-(hydrazinylmethyl)benzene-1,2,3-triol;methanol?
The InChIKey is OITNVDWKAYXSQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3.CH4O/c8-9-3-4-1-2-5(10)7(12)6(4)11;1-2/h1-2,9-12H,3,8H2;2H,1H3.
What are the key properties of 4-(hydrazinylmethyl)benzene-1,2,3-triol;methanol?
4-(hydrazinylmethyl)benzene-1,2,3-triol;methanol has a molecular weight of 202.21 g/mol, XLogP of -0.62, 2 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydrazinylmethyl)benzene-1,2,3-triol;methanol is sourced from PubChem (CID 90472349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).