C8H14N2O4 — CID 90472349
4-(hydrazinylmethyl)benzene-1,2,3-triol;methanol (PubChem CID 90472349) has the molecular formula C8H14N2O4 and a molecular weight of 202.21 g/mol. Its IUPAC name is 4-(hydrazinylmethyl)benzene-1,2,3-triol;methanol.
| Compound Name | 4-(hydrazinylmethyl)benzene-1,2,3-triol;methanol |
|---|---|
| PubChem CID | 90472349 |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 4-(hydrazinylmethyl)benzene-1,2,3-triol;methanol |
| SMILES | CO.NNCc1ccc(O)c(O)c1O |
| InChI | InChI=1S/C7H10N2O3.CH4O/c8-9-3-4-1-2-5(10)7(12)6(4)11;1-2/h1-2,9-12H,3,8H2;2H,1H3 |
| InChIKey | OITNVDWKAYXSQO-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|