C9H12N2O7 — CID 175673177
4-[(azanyl(15N)amino)methyl]benzene-1,2,3-triol;oxalic acid (PubChem CID 175673177) has the molecular formula C9H12N2O7 and a molecular weight of 262.19 g/mol. Its IUPAC name is 4-[(azanyl(15N)amino)methyl]benzene-1,2,3-triol;oxalic acid.
| Compound Name | 4-[(azanyl(15N)amino)methyl]benzene-1,2,3-triol;oxalic acid |
|---|---|
| PubChem CID | 175673177 |
| Molecular Formula | C9H12N2O7 |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 4-[(azanyl(15N)amino)methyl]benzene-1,2,3-triol;oxalic acid |
| SMILES | O=C(O)C(=O)O.[15NH2][15NH]Cc1ccc(O)c(O)c1O |
| InChI | InChI=1S/C7H10N2O3.C2H2O4/c8-9-3-4-1-2-5(10)7(12)6(4)11;3-1(4)2(5)6/h1-2,9-12H,3,8H2;(H,3,4)(H,5,6)/i8+1,9+1; |
| InChIKey | UXROYWXIBUNFBK-KCJWSGGHSA-N |
| XLogP | -1.08 |
| TPSA | 173.34 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|