C10H15N3O5 — CID 23615580
2-amino-1-[5-(hydrazinylmethyl)-2,3,4-trihydroxyphenyl]-3-hydroxypropan-1-one (PubChem CID 23615580) has the molecular formula C10H15N3O5 and a molecular weight of 257.25 g/mol. Its IUPAC name is 2-amino-1-[5-(hydrazinylmethyl)-2,3,4-trihydroxyphenyl]-3-hydroxypropan-1-one.
| Compound Name | 2-amino-1-[5-(hydrazinylmethyl)-2,3,4-trihydroxyphenyl]-3-hydroxypropan-1-one |
|---|---|
| PubChem CID | 23615580 |
| Molecular Formula | C10H15N3O5 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-amino-1-[5-(hydrazinylmethyl)-2,3,4-trihydroxyphenyl]-3-hydroxypropan-1-one |
| SMILES | NNCc1cc(C(=O)C(N)CO)c(O)c(O)c1O |
| InChI | InChI=1S/C10H15N3O5/c11-6(3-14)8(16)5-1-4(2-13-12)7(15)10(18)9(5)17/h1,6,13-15,17-18H,2-3,11-12H2 |
| InChIKey | PSQLWHRWOVEBNO-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 162.06 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|