C16H16O7 — CID 19910474
(3,4,5-trihydroxyphenyl)-(2,3,4-trihydroxy-5-propylphenyl)methanone (PubChem CID 19910474) has the molecular formula C16H16O7 and a molecular weight of 320.30 g/mol. Its IUPAC name is (3,4,5-trihydroxyphenyl)-(2,3,4-trihydroxy-5-propylphenyl)methanone.
| Compound Name | (3,4,5-trihydroxyphenyl)-(2,3,4-trihydroxy-5-propylphenyl)methanone |
|---|---|
| PubChem CID | 19910474 |
| Molecular Formula | C16H16O7 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | (3,4,5-trihydroxyphenyl)-(2,3,4-trihydroxy-5-propylphenyl)methanone |
| SMILES | CCCc1cc(C(=O)c2cc(O)c(O)c(O)c2)c(O)c(O)c1O |
| InChI | InChI=1S/C16H16O7/c1-2-3-7-4-9(14(21)16(23)13(7)20)12(19)8-5-10(17)15(22)11(18)6-8/h4-6,17-18,20-23H,2-3H2,1H3 |
| InChIKey | NVXYENVXMBECED-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|