C20H16O6 — CID 19910307
(5-benzyl-2,4-dihydroxyphenyl)-(3,4,5-trihydroxyphenyl)methanone (PubChem CID 19910307) has the molecular formula C20H16O6 and a molecular weight of 352.34 g/mol. Its IUPAC name is (5-benzyl-2,4-dihydroxyphenyl)-(3,4,5-trihydroxyphenyl)methanone.
| Compound Name | (5-benzyl-2,4-dihydroxyphenyl)-(3,4,5-trihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 19910307 |
| Molecular Formula | C20H16O6 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (5-benzyl-2,4-dihydroxyphenyl)-(3,4,5-trihydroxyphenyl)methanone |
| SMILES | O=C(c1cc(O)c(O)c(O)c1)c1cc(Cc2ccccc2)c(O)cc1O |
| InChI | InChI=1S/C20H16O6/c21-15-10-16(22)14(7-12(15)6-11-4-2-1-3-5-11)19(25)13-8-17(23)20(26)18(24)9-13/h1-5,7-10,21-24,26H,6H2 |
| InChIKey | MMABUSGYMPZHGD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|