C21H28O — CID 21430785
2-benzyl-4,5-ditert-butylphenol (PubChem CID 21430785) has the molecular formula C21H28O and a molecular weight of 296.45 g/mol. Its IUPAC name is 2-benzyl-4,5-ditert-butylphenol.
| Compound Name | 2-benzyl-4,5-ditert-butylphenol |
|---|---|
| PubChem CID | 21430785 |
| Molecular Formula | C21H28O |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 2-benzyl-4,5-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(O)c(Cc2ccccc2)cc1C(C)(C)C |
| InChI | InChI=1S/C21H28O/c1-20(2,3)17-13-16(12-15-10-8-7-9-11-15)19(22)14-18(17)21(4,5)6/h7-11,13-14,22H,12H2,1-6H3 |
| InChIKey | UAEXDUPBGPJHQF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |