C30H38 — CID 174009855
1,4-ditert-butyl-2,5-bis[(4-methylphenyl)methyl]benzene (PubChem CID 174009855) has the molecular formula C30H38 and a molecular weight of 398.63 g/mol. Its IUPAC name is 1,4-ditert-butyl-2,5-bis[(4-methylphenyl)methyl]benzene.
| Compound Name | 1,4-ditert-butyl-2,5-bis[(4-methylphenyl)methyl]benzene |
|---|---|
| PubChem CID | 174009855 |
| Molecular Formula | C30H38 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | 1,4-ditert-butyl-2,5-bis[(4-methylphenyl)methyl]benzene |
| SMILES | Cc1ccc(Cc2cc(C(C)(C)C)c(Cc3ccc(C)cc3)cc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H38/c1-21-9-13-23(14-10-21)17-25-19-28(30(6,7)8)26(20-27(25)29(3,4)5)18-24-15-11-22(2)12-16-24/h9-16,19-20H,17-18H2,1-8H3 |
| InChIKey | GMVGBSPMTMEICH-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |