C24H22O4 — CID 22269445
4,6-bis[(4-methylphenyl)methyl]benzene-1,3-dicarboxylic acid (PubChem CID 22269445) has the molecular formula C24H22O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 4,6-bis[(4-methylphenyl)methyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 4,6-bis[(4-methylphenyl)methyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 22269445 |
| Molecular Formula | C24H22O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 4,6-bis[(4-methylphenyl)methyl]benzene-1,3-dicarboxylic acid |
| SMILES | Cc1ccc(Cc2cc(Cc3ccc(C)cc3)c(C(=O)O)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C24H22O4/c1-15-3-7-17(8-4-15)11-19-13-20(12-18-9-5-16(2)6-10-18)22(24(27)28)14-21(19)23(25)26/h3-10,13-14H,11-12H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | OWCGZQCZNIZLJA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |