C20H28O2 — CID 143911698
ethane;3-methyl-5-[(4-methylphenyl)methyl]benzoic acid (PubChem CID 143911698) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is ethane;3-methyl-5-[(4-methylphenyl)methyl]benzoic acid.
| Compound Name | ethane;3-methyl-5-[(4-methylphenyl)methyl]benzoic acid |
|---|---|
| PubChem CID | 143911698 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | ethane;3-methyl-5-[(4-methylphenyl)methyl]benzoic acid |
| SMILES | CC.CC.Cc1ccc(Cc2cc(C)cc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C16H16O2.2C2H6/c1-11-3-5-13(6-4-11)9-14-7-12(2)8-15(10-14)16(17)18;2*1-2/h3-8,10H,9H2,1-2H3,(H,17,18);2*1-2H3 |
| InChIKey | SJVVHOFQLLSOEU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |