C25H30 — CID 159821792
4-benzyl-1,6-ditert-butylnaphthalene (PubChem CID 159821792) has the molecular formula C25H30 and a molecular weight of 330.51 g/mol. Its IUPAC name is 4-benzyl-1,6-ditert-butylnaphthalene.
| Compound Name | 4-benzyl-1,6-ditert-butylnaphthalene |
|---|---|
| PubChem CID | 159821792 |
| Molecular Formula | C25H30 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 4-benzyl-1,6-ditert-butylnaphthalene |
| SMILES | CC(C)(C)c1ccc2c(C(C)(C)C)ccc(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C25H30/c1-24(2,3)20-13-14-21-22(17-20)19(12-15-23(21)25(4,5)6)16-18-10-8-7-9-11-18/h7-15,17H,16H2,1-6H3 |
| InChIKey | KJDUBCFAGRLSKV-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |