C60H70Si — CID 123408205
tris(4-benzyl-3-tert-butylphenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 123408205) has the molecular formula C60H70Si and a molecular weight of 819.31 g/mol. Its IUPAC name is tris(4-benzyl-3-tert-butylphenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane.
| Compound Name | tris(4-benzyl-3-tert-butylphenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 123408205 |
| Molecular Formula | C60H70Si |
| Molecular Weight | 819.31 g/mol |
| Exact Mass | 818.52 |
| IUPAC Name | tris(4-benzyl-3-tert-butylphenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | CC1=C(C)C(C)C([Si](c2ccc(Cc3ccccc3)c(C(C)(C)C)c2)(c2ccc(Cc3ccccc3)c(C(C)(C)C)c2)c2ccc(Cc3ccccc3)c(C(C)(C)C)c2)=C1C |
| InChI | InChI=1S/C60H70Si/c1-41-42(2)44(4)57(43(41)3)61(51-32-29-48(54(38-51)58(5,6)7)35-45-23-17-14-18-24-45,52-33-30-49(55(39-52)59(8,9)10)36-46-25-19-15-20-26-46)53-34-31-50(56(40-53)60(11,12)13)37-47-27-21-16-22-28-47/h14-34,38-40,43H,35-37H2,1-13H3 |
| InChIKey | GTMCWSSAAZDDIZ-UHFFFAOYSA-N |
| XLogP | 13.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.31 |
| LogP ≤ 5 | 13.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|