C39H52Si — CID 86667942
tris(4-butylphenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 86667942) has the molecular formula C39H52Si and a molecular weight of 548.93 g/mol. Its IUPAC name is tris(4-butylphenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane.
| Compound Name | tris(4-butylphenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 86667942 |
| Molecular Formula | C39H52Si |
| Molecular Weight | 548.93 g/mol |
| Exact Mass | 548.38 |
| IUPAC Name | tris(4-butylphenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | CCCCc1ccc([Si](C2=C(C)C(C)=C(C)C2C)(c2ccc(CCCC)cc2)c2ccc(CCCC)cc2)cc1 |
| InChI | InChI=1S/C39H52Si/c1-8-11-14-33-17-23-36(24-18-33)40(39-31(6)29(4)30(5)32(39)7,37-25-19-34(20-26-37)15-12-9-2)38-27-21-35(22-28-38)16-13-10-3/h17-28,31H,8-16H2,1-7H3 |
| InChIKey | KEUQJZXNGDGVHM-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.93 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|