C39H52Si — CID 123313636
(2-butylcyclopenta-1,3-dien-1-yl)-tris(4-butylphenyl)silane (PubChem CID 123313636) has the molecular formula C39H52Si and a molecular weight of 548.93 g/mol. Its IUPAC name is (2-butylcyclopenta-1,3-dien-1-yl)-tris(4-butylphenyl)silane.
| Compound Name | (2-butylcyclopenta-1,3-dien-1-yl)-tris(4-butylphenyl)silane |
|---|---|
| PubChem CID | 123313636 |
| Molecular Formula | C39H52Si |
| Molecular Weight | 548.93 g/mol |
| Exact Mass | 548.38 |
| IUPAC Name | (2-butylcyclopenta-1,3-dien-1-yl)-tris(4-butylphenyl)silane |
| SMILES | CCCCC1=C([Si](c2ccc(CCCC)cc2)(c2ccc(CCCC)cc2)c2ccc(CCCC)cc2)CC=C1 |
| InChI | InChI=1S/C39H52Si/c1-5-9-14-32-20-26-36(27-21-32)40(39-19-13-18-35(39)17-12-8-4,37-28-22-33(23-29-37)15-10-6-2)38-30-24-34(25-31-38)16-11-7-3/h13,18,20-31H,5-12,14-17,19H2,1-4H3 |
| InChIKey | KUIYWRQEJWSUBD-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.93 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|