C29H32Si — CID 123280881
(4-butylphenyl)-(2,4-dimethylcyclopenta-1,3-dien-1-yl)-diphenylsilane (PubChem CID 123280881) has the molecular formula C29H32Si and a molecular weight of 408.66 g/mol. Its IUPAC name is (4-butylphenyl)-(2,4-dimethylcyclopenta-1,3-dien-1-yl)-diphenylsilane.
| Compound Name | (4-butylphenyl)-(2,4-dimethylcyclopenta-1,3-dien-1-yl)-diphenylsilane |
|---|---|
| PubChem CID | 123280881 |
| Molecular Formula | C29H32Si |
| Molecular Weight | 408.66 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | (4-butylphenyl)-(2,4-dimethylcyclopenta-1,3-dien-1-yl)-diphenylsilane |
| SMILES | CCCCc1ccc([Si](C2=C(C)C=C(C)C2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H32Si/c1-4-5-12-25-17-19-28(20-18-25)30(26-13-8-6-9-14-26,27-15-10-7-11-16-27)29-22-23(2)21-24(29)3/h6-11,13-21H,4-5,12,22H2,1-3H3 |
| InChIKey | PKINLEOQUSJYFZ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.66 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|