C35H44Si — CID 173474111
bis(4-butylphenyl)-phenyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 173474111) has the molecular formula C35H44Si and a molecular weight of 492.82 g/mol. Its IUPAC name is bis(4-butylphenyl)-phenyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | bis(4-butylphenyl)-phenyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 173474111 |
| Molecular Formula | C35H44Si |
| Molecular Weight | 492.82 g/mol |
| Exact Mass | 492.32 |
| IUPAC Name | bis(4-butylphenyl)-phenyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CCCCc1ccc([Si](c2ccccc2)(c2ccc(CCCC)cc2)C2(C)C=C(C)C(C)=C2C)cc1 |
| InChI | InChI=1S/C35H44Si/c1-7-9-14-30-18-22-33(23-19-30)36(32-16-12-11-13-17-32,35(6)26-27(3)28(4)29(35)5)34-24-20-31(21-25-34)15-10-8-2/h11-13,16-26H,7-10,14-15H2,1-6H3 |
| InChIKey | GWVITPUGAQTDRP-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.82 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|