C35H48Si3 — CID 173474312
(3,5-dimethylphenyl)-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)-bis(4-trimethylsilylphenyl)silane (PubChem CID 173474312) has the molecular formula C35H48Si3 and a molecular weight of 553.03 g/mol. Its IUPAC name is (3,5-dimethylphenyl)-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)-bis(4-trimethylsilylphenyl)silane.
| Compound Name | (3,5-dimethylphenyl)-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)-bis(4-trimethylsilylphenyl)silane |
|---|---|
| PubChem CID | 173474312 |
| Molecular Formula | C35H48Si3 |
| Molecular Weight | 553.03 g/mol |
| Exact Mass | 552.31 |
| IUPAC Name | (3,5-dimethylphenyl)-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)-bis(4-trimethylsilylphenyl)silane |
| SMILES | CC1=CC(C)([Si](c2ccc([Si](C)(C)C)cc2)(c2ccc([Si](C)(C)C)cc2)c2cc(C)cc(C)c2)C(C)=C1C |
| InChI | InChI=1S/C35H48Si3/c1-25-21-26(2)23-34(22-25)38(35(6)24-27(3)28(4)29(35)5,32-17-13-30(14-18-32)36(7,8)9)33-19-15-31(16-20-33)37(10,11)12/h13-24H,1-12H3 |
| InChIKey | YFULLQRLDWDACD-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.03 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|