C30H34O3Si — CID 173474365
tris(4-methoxyphenyl)-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 173474365) has the molecular formula C30H34O3Si and a molecular weight of 470.69 g/mol. Its IUPAC name is tris(4-methoxyphenyl)-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | tris(4-methoxyphenyl)-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 173474365 |
| Molecular Formula | C30H34O3Si |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | tris(4-methoxyphenyl)-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | COc1ccc([Si](c2ccc(OC)cc2)(c2ccc(OC)cc2)C2(C)C=C(C)C(C)=C2C)cc1 |
| InChI | InChI=1S/C30H34O3Si/c1-21-20-30(4,23(3)22(21)2)34(27-14-8-24(31-5)9-15-27,28-16-10-25(32-6)11-17-28)29-18-12-26(33-7)13-19-29/h8-20H,1-7H3 |
| InChIKey | ILSRSNNCEYALEA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|