C21H22O — CID 10017114
1-methoxy-4-(3,3,5-trimethyl-2-phenylcyclopenta-1,4-dien-1-yl)benzene (PubChem CID 10017114) has the molecular formula C21H22O and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-methoxy-4-(3,3,5-trimethyl-2-phenylcyclopenta-1,4-dien-1-yl)benzene.
| Compound Name | 1-methoxy-4-(3,3,5-trimethyl-2-phenylcyclopenta-1,4-dien-1-yl)benzene |
|---|---|
| PubChem CID | 10017114 |
| Molecular Formula | C21H22O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 1-methoxy-4-(3,3,5-trimethyl-2-phenylcyclopenta-1,4-dien-1-yl)benzene |
| SMILES | COc1ccc(C2=C(c3ccccc3)C(C)(C)C=C2C)cc1 |
| InChI | InChI=1S/C21H22O/c1-15-14-21(2,3)20(17-8-6-5-7-9-17)19(15)16-10-12-18(22-4)13-11-16/h5-14H,1-4H3 |
| InChIKey | DHTFMJUMHBVMPS-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|