C25H21NO5 — CID 141397576
3,4-bis(4-methoxyphenyl)-1-phenylmethoxypyrrole-2,5-dione (PubChem CID 141397576) has the molecular formula C25H21NO5 and a molecular weight of 415.45 g/mol. Its IUPAC name is 3,4-bis(4-methoxyphenyl)-1-phenylmethoxypyrrole-2,5-dione.
| Compound Name | 3,4-bis(4-methoxyphenyl)-1-phenylmethoxypyrrole-2,5-dione |
|---|---|
| PubChem CID | 141397576 |
| Molecular Formula | C25H21NO5 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 3,4-bis(4-methoxyphenyl)-1-phenylmethoxypyrrole-2,5-dione |
| SMILES | COc1ccc(C2=C(c3ccc(OC)cc3)C(=O)N(OCc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C25H21NO5/c1-29-20-12-8-18(9-13-20)22-23(19-10-14-21(30-2)15-11-19)25(28)26(24(22)27)31-16-17-6-4-3-5-7-17/h3-15H,16H2,1-2H3 |
| InChIKey | MKCYBZCDIQQSPG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|