C26H23NO6 — CID 141397575
3,4-diphenyl-1-[(3,4,5-trimethoxyphenyl)methoxy]pyrrole-2,5-dione (PubChem CID 141397575) has the molecular formula C26H23NO6 and a molecular weight of 445.47 g/mol. Its IUPAC name is 3,4-diphenyl-1-[(3,4,5-trimethoxyphenyl)methoxy]pyrrole-2,5-dione.
| Compound Name | 3,4-diphenyl-1-[(3,4,5-trimethoxyphenyl)methoxy]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 141397575 |
| Molecular Formula | C26H23NO6 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 3,4-diphenyl-1-[(3,4,5-trimethoxyphenyl)methoxy]pyrrole-2,5-dione |
| SMILES | COc1cc(CON2C(=O)C(c3ccccc3)=C(c3ccccc3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C26H23NO6/c1-30-20-14-17(15-21(31-2)24(20)32-3)16-33-27-25(28)22(18-10-6-4-7-11-18)23(26(27)29)19-12-8-5-9-13-19/h4-15H,16H2,1-3H3 |
| InChIKey | ZDPDXEKXNRWDMV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|